| штат: | |
|---|---|
| PDF экспорт | |
4559-86-8
Boss Chemical
4559-86-8
Tetrabutylurea Basic information | |
Product Name: | Tetrabutylurea |
CAS: | 4559-86-8 |
MF: | C17H36N2O |
MW: | 284.48 |
EINECS: | 224-929-8 |
Mol File: | 4559-86-8.mol |
Tetrabutylurea Chemical Properties | |
Melting point | -60 °C |
Boiling point | 163 °C / 12mmHg |
density | 0.88 |
vapor pressure | 0.019Pa at 20℃ |
refractive index | 1.4520-1.4560 |
Fp | 93 °C |
storage temp. | Store at room temperature |
pka | -0.61±0.70(Predicted) |
form | clear liquid |
color | Colorless to Light yellow to Light orange |
Water Solubility | 4.3mg/L at 20℃ |
InChI | InChI=1S/C17H36N2O/c1-5-9-13-18(14-10-6-2)17(20)19(15-11-7-3)16-12-8-4/h5-16H2,1-4H3 |
InChIKey | SNDGLCYYBKJSOT-UHFFFAOYSA-N |
SMILES | N(CCCC)(CCCC)C(N(CCCC)CCCC)=O |
LogP | 6.2 at 25℃ |
CAS DataBase Reference | 4559-86-8(CAS DataBase Reference) |
NIST Chemistry Reference | Urea, tetrabutyl-(4559-86-8) |
EPA Substance Registry System | Urea, tetrabutyl- (4559-86-8) |
Item | Inspection standard | Inspection Results |
Appearance | Clear Liquid | Clear Liquid |
Purity % ≥ | 99.5 | 99.60 |
Dibutylamine %≤ | 0.05 | 0.04 |
Density (20℃)g/cm3 | 0.874~0.880 | 0.875 |
Color,APHA ≤ | 30 | 5.3 |
Sulphur PPM ≤ | 1 | 0.10 |
Cl PPM ≤ | 5 | 0.94 |
Water % ≤ | 0.1 | 0.04 |
Flash point ℃ ≥ | 140 | 158 |